| Name | 2-Benzylcyclohexanone |
| Synonyms | 2-Benzylcyclohexanone 2-BENZYLCYCLOHEXANONE 2-Benzylcyclohexan-1-one 2-benzylcyclohexan-1-one 2-Benzylcyclohexane-1-one Cyclohexanone, 2-(phenylmethyl)- |
| CAS | 946-33-8 |
| EINECS | 213-420-6 |
| InChI | InChI=1/C13H16O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2 |
| Molecular Formula | C13H16O |
| Molar Mass | 188.27 |
| Density | 1.024 g/mL at 25 °C (lit.) |
| Melting Point | 28-30°C |
| Boling Point | 103-105 °C/0.2 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.000939mmHg at 25°C |
| BRN | 2046670 |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.536(lit.) |
| MDL | MFCD00051455 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |