| Product Name | acteoside |
| Synonyms | Acetoside acteoside verbascoside Verbascoside VERBASCOSIDE WITH HPLC 3,4-Dihydroxyphenethyl alcohol acteoside Extract from Verbena minutiflora (B864379) |
| CAS | 61276-17-3 |
| EINECS | |
| Chemical Formula | C29H36O15 |
| Molecular Weight | 624.59 |
| inchi | InChI=1/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27+,28+,29-/m0/s1 |
| Package | 1kg, 10kg, 100kg |
| Price | Tel/Email |
| Descriptions | Plant extracts, widely used in cosmetics, medicine, feed and other fields |
| Supplier Website | http://www.staherb.com |
| Last Update | 2024-02-03 15:41:13 |