| Supplier Name | |
| Tel | |
| Mobile | 13957167880 |
| triggerchem@126.com | |
| Website | http://www.triggerchem.cn |
| Product Name | (3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S. |
| Synonyms | nt21 AURORA KA-6872 CHLOROHYDROXY PROPYLTRIMETHYL AMMONIUMCHLORIDE 3-chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride (3-chloro-2-hydroxypropyl)trimethyl-ammoniuchloride |
| CAS | 3327-22-8 |
| EINECS | 222-048-3 |
| Chemical Formula | C6H15Cl2NO |
| Molecular Weight | 188.1 |
| inchi | InChI=1/C3H8ClNO.ClH/c4-1-3(6)2-5;/h3,6H,1-2,5H2;1H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |