| Product Name | Methyl 2-Fluoroacrylate |
| Synonyms | 2-FLUOROACRYLATE Methyl fluoroacrylate METHYL 2-FLUOROACRYLATE Methyl 2-Fluoroacrylate methyl 2-fluoroprop-2-enoate Methyl 2-fluoroprop-2-enoate 2-Fluoroacrylic acid methyl ester |
| CAS | 2343-89-7 |
| EINECS | |
| Chemical Formula | C4H5FO2 |
| Molecular Weight | 104.08 |
| inchi | InChI=1/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3 |
| Package | 25KG/Drum |
| Price | RFQ |
| Descriptions | 2-Fluoroacrylate methyl ester has important applications in the pharmaceutical and materials industries, and is a useful synthetic intermediate for pharmaceuticals, coatings, semiconductor photoresist materials, etc. Its industrial production volume is increasing year by year. 2-fluoroacrylate methyl ester is a key monomer in the production of fluorinated polymer optical fiber materials, and 2-fluoropropionate ester is a key intermediate in the synthesis of 2-fluoroacrylate methyl ester. |
| Supplier Website | |
| Last Update | 2025-10-30 08:44:22 |