![]() | |
| Supplier Name | Jiangsu Pules Biotechnology Co.,Ltd. |
| Contact | Miss Yang |
| Tel | 0513-66814854 |
| Mobile | +86-17551318830 |
| pules.cn@gmail.com | |
| Website | http://www.pules.cn/en/ |
| Product Name | Dimethylaminoethyl methacrylate |
| Synonyms | DM DMAM MADAM DMAEMA ageflexfm-1 Ageflex fm-1 N,N-dimethylamino methacrylate |
| CAS | 2867-47-2 |
| EINECS | 220-688-8 |
| Chemical Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| inchi | InChI=1/C8H15NO2/c1-6(2)8(10)11-7(3)9(4)5/h7H,1H2,2-5H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2025-10-31 15:29:18 |