| Product Name | 7-Ethyl-10-hydroxycamptothecin |
| Synonyms | SN-38 Intermediate of Irinotecan 1 7-Ethyl-10-hydroxycamptothecin 7-ethyl-10-hydroxy camptothecin 7-Ethyl-10-Hydroxy-Camptothecin 7-Ethyl-10-hydroxycamptothecine 7-ethyl-10-hydroxy-camptothecine |
| CAS | 86639-52-3;130194-92-2;119577-28-5;130144-34-2;110714-48-2;113015-38-6 |
| EINECS | |
| Chemical Formula | C22H20N2O5 |
| Molecular Weight | 392.4 |
| inchi | InChI=1/C20H16N2O5/c1-2-20(26)13-7-15-17-10(6-11-14(21-17)4-3-5-16(11)23)8-22(15)18(24)12(13)9-27-19(20)25/h3-7,23,26H,2,8-9H2,1H3/t20-/m0/s1 |
| Package | 1kg, 10kg, 100kg |
| Price | Email to quote |
| Descriptions | Plant extracts, widely used in cosmetics, medicine, feed and other fields |
| Supplier Website | http://www.staherb.com |
| Last Update | 2024-07-15 11:06:40 |