![]() | |
| Supplier Name | CHEMBSF (Shanghai) Biomedical Technology Co., Ltd |
| Contact | DIAO |
| Tel | 021-60556179 |
| Mobile | +86-18721521379 |
| 18721521379@163.com | |
| Website | http://www.chembsf.com |
| 18721521379 | |
| Product Name | Methyl caprylate |
| Synonyms | Methyl caprylate Methyl Octanoate Methyl n-octanoate Methyl n-Octanoate methylesteroctanoicacid Caprylic Acid Methyl Ester Methyl ester of octanoic acid |
| CAS | 111-11-5 |
| EINECS | 203-835-0 |
| Chemical Formula | C9H18O2 |
| Molecular Weight | 158.24 |
| inchi | InChI=1/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2025-10-31 13:30:40 |