![]() | |
| Supplier Name | CHEMBSF (Shanghai) Biomedical Technology Co., Ltd |
| Contact | DIAO |
| Tel | 021-60556179 |
| Mobile | +86-18721521379 |
| 18721521379@163.com | |
| Website | http://www.chembsf.com |
| 18721521379 | |
| Product Name | 5'-bromo-2'-hydroxyacetophenone |
| Synonyms | AKOS BBS-00006622 2-ACETYL-4-BROMOPHENOL 2-acetyl-4-bromophenol 5-bromo-2-hydroxyacetophenone 5-BROMO-2-HYDROXYACETOPHENONE 5'-bromo-2'-hydroxy-acetophenon 2'-hydroxy-5'-bromoacetophenone |
| CAS | 1450-75-5 |
| EINECS | 604-457-2 |
| Chemical Formula | C8H7BrO2 |
| Molecular Weight | 215.04 |
| inchi | InChI=1/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2025-10-24 13:47:20 |