![]() | |
| Supplier Name | Wuhan UCchem Biotechnology Co., LTD |
| Contact | ZHOU |
| Tel | +86-18162425036 |
| Mobile | 18162425036 |
| 3866263148@qq.com | |
| Website | http://www.jxybchem.com/en/ |
| 18162425036 | |
| Product Name | 1-Naphthylboronic acid |
| Synonyms | RARECHEM AH PB 0125 1-Naphthylbenzoic acid 1-Naphthylboronic acid (1-Naphthyl)boranediol 1-Naphthylboranic acid (1-Naphthyl)boranic acid ALPHA-NAPHTHYLBORIC ACID |
| CAS | 13922-41-3 |
| EINECS | 604-119-4 |
| Chemical Formula | C10H9BO2 |
| Molecular Weight | 171.99 |
| inchi | InChI=1/C10H9BO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12-13H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2025-12-31 14:37:58 |