![]() | |
| Supplier Name | Jiangsu Pules Biotechnology Co.,Ltd. |
| Contact | Miss Yang |
| Tel | 0513-66814854 |
| Mobile | +86-17551318830 |
| pules.cn@gmail.com | |
| Website | http://www.pules.cn/en/ |
| Product Name | Thiocarbanilide |
| Synonyms | Thiocarbanilide Diphenylthiourea 2-Fenylotiomocznik sym-Diphenylthiourea 1,3-diphenylthiourea N,N'Diphenylthiourea Rubber Accelerator CA |
| CAS | 102-08-9 |
| EINECS | 203-004-2 |
| Chemical Formula | C13H12N2S |
| Molecular Weight | 228.31 |
| inchi | InChI=1/C13H12N2S/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15,16) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-04-21 10:35:23 |