![]() | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | http://www.bocsci.com/ |
| http://www.linkedin.com/company/boc-sciences | |
| Product Name | [2-[2-(Fmoc-amino)ethoxy]ethoxy]acetic acid |
| Synonyms | Fmoc-AEEA-OH Fmoc-Aeea-Oh Fmoc-Aeeac-Oh Rarechem Em Wb 0032 Fmoc-PEG2-acetic acid 8-(FMOC-AMINO)-3,6-DIOXA-OCTANOIC ACID 8-(Fmoc-Amino)-3,6-Dioxa-Octanoic Acid |
| CAS | 166108-71-0 |
| EINECS | 200-111-8 |
| Chemical Formula | C21H23NO6 |
| Molecular Weight | 385.41 |
| inchi | InChI=1/C21H23NO6/c23-20(24)14-27-12-11-26-10-9-22-21(25)28-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-14H2,(H,22,25)(H,23,24) |
| Package | 10 g |
| Price | $299 |
| Descriptions | Fmoc-N-amido-PEG2-acetic acid Fmoc-AEEA-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Supplier Website | http://aapep.bocsci.com/product/fmoc-n-amido-peg2-acetic-acid-cas-166108-71-0-364059.html |
| Last Update | 2025-04-30 11:27:47 |