![]() | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | http://www.bocsci.com/ |
| http://www.linkedin.com/company/boc-sciences | |
| Product Name | (s)-10-hydroxycamptothecin |
| Synonyms | 160177 10-HCPT Hydroxycamptothecin Hydroxy Camptothecine Hydroxy camptothecine 10-Hydroxycamp-totecin 10-hydroxycamptothecin |
| CAS | 64439-81-2;19685-09-7 |
| EINECS | 613-598-9 |
| Chemical Formula | C20H16N2O5 |
| Molecular Weight | 364.35 |
| inchi | InChI=1/C20H16N2O5/c1-2-20(26)14-7-16-17-11(5-10-6-12(23)3-4-15(10)21-17)8-22(16)18(24)13(14)9-27-19(20)25/h3-7,23,26H,2,8-9H2,1H3/t20-/m0/s1 |
| Package | 1 g |
| Price | $199 |
| Descriptions | (±)-10-Hydroxycamptothecin (±)-10-Hydroxycamptothecin is an alkaloid derived from the seed or root bark of the deciduous plant Camptotheca acuminata. It has selective inhibitory effect on the phosphorylation of histone H1 and H3, but less effect on other histones. It exhibits anticancer and antiangiogenic activities. It can be used in cosmetics material. |
| Supplier Website | http://www.bocsci.com/product/10-hydroxycamptothecin-cas-64439-81-2-51417.html |
| Last Update | 2025-04-30 11:27:47 |