Request for quotation
Supplier Contact
 | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | http://www.bocsci.com/ |
| http://www.linkedin.com/company/boc-sciences | |
| Product Name | 2,3-dimethylindazol-6-amine hydrochloride |
| Synonyms | PAZ20 Pazopanib Impurity 21 2,3-dimethyl-2H-indazol-6-amine HCl 2,3-dimethylindazol-6-amine hydrochloride 6-amino-2,3-dimethylindazole hydrochloride 3-Methyl-6-nitro-1H-indazole hydrochloride |
| CAS | 635702-60-2 |
| EINECS | 200-001-8 |
| Chemical Formula | C9H12ClN3 |
| Molecular Weight | 197.66468 |
| inchi | InChI=1/C9H11N3.ClH/c1-6-8-4-3-7(10)5-9(8)11-12(6)2;/h3-5H,10H2,1-2H3;1H |
| Package | 100 g |
| Price | $319 |
| Descriptions | 6-Amino-2,3-dimethyl-2H-indazole Hydrochloride An impurity of Pazopanib, which is a novel multi-target inhibitor of VEGFR1, VEGFR2, VEGFR3, PDGFR, FGFR, c-Kit and c-Fms. |
| Supplier Website | http://www.bocsci.com/product/6-amino-2-3-dimethyl-2h-indazole-cas-635702-60-2-323943.html |
| Last Update | 2025-04-30 11:27:47 |