![]() | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | http://www.bocsci.com/ |
| http://www.linkedin.com/company/boc-sciences | |
| Product Name | Ceftibuten dihydrate |
| Synonyms | Cetb Cedax Sch-39720 Cedax (tn) CEDAX DIHYDRATE Cedax dihydrate Ceftibuten (jp15) |
| CAS | 118081-34-8 |
| EINECS | |
| Chemical Formula | C15H14N4O6S2.2H2O |
| Molecular Weight | 446.459 |
| inchi | InChI=1/C15H14N4O6S2.2H2O/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19;;/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25);2*1H2/b6-1-;;/t10-,13-;;/m1../s1 |
| Package | 100 mg |
| Price | $199 |
| Descriptions | Ceftibuten Dihydrate Dihydrate form of Ceftibuten which is one of the third-generation cephalosporin antibiotics. |
| Supplier Website | http://www.bocsci.com/product/ceftibuten-dihydrate-cas-118081-34-8-55292.html |
| Last Update | 2025-04-30 11:27:47 |