![]() | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | http://www.bocsci.com/ |
| http://www.linkedin.com/company/boc-sciences | |
| Product Name | diacerein |
| Synonyms | artrodar DIACEREIN diacerein DIACERHEIN Diacerhein DIACETYL RHEIN 1,8-Diacetoxy-3-carboxyanthraquinone |
| CAS | 13739-02-1 |
| EINECS | 237-310-2 |
| Chemical Formula | C19H12O8 |
| Molecular Weight | 368.29 |
| inchi | InChI=1/C19H12O8/c1-8(20)26-13-5-3-4-11-15(13)18(23)16-12(17(11)22)6-10(19(24)25)7-14(16)27-9(2)21/h3-7H,1-2H3,(H,24,25) |
| Package | 100 g |
| Price | $599 |
| Descriptions | Diacerein Diacerin is an inhibitor of pro-inflammatory cytokine Interleukin-1B (IL-1B) production, prescribed for osteoarthritis and chronic inflammatory arthritis. |
| Supplier Website | http://www.bocsci.com/product/diacerein-cas-13739-02-1-58058.html |
| Last Update | 2025-04-30 11:27:47 |