Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate structure
|
Common Name | Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 104197-39-9 | Molecular Weight | 336.33700 | |
| Density | 1.199g/cm3 | Boiling Point | 466.2ºC at 760 mmHg | |
| Molecular Formula | C17H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | Methyl 4,6,7-trimethoxy-5-(methoxymethoxy)-2-naphthoate |
|---|
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760 mmHg |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.33700 |
| Flash Point | 205.3ºC |
| Exact Mass | 336.12100 |
| PSA | 72.45000 |
| LogP | 2.63490 |
| Vapour Pressure | 7.23E-09mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | NHYIBAIDSJMZOW-UHFFFAOYSA-N |
| SMILES | COCOc1c(OC)c(OC)cc2cc(C(=O)OC)cc(OC)c12 |
|
~70%
Methyl 4,6,7-tr... CAS#:104197-39-9 |
| Literature: Johnson; Marinelli Journal of Organic Chemistry, 1986 , vol. 51, # 20 p. 3911 - 3913 |
|
~%
Methyl 4,6,7-tr... CAS#:104197-39-9 |
| Literature: Johnson; Marinelli Journal of Organic Chemistry, 1986 , vol. 51, # 20 p. 3911 - 3913 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |