3,7,11,15-TETRAMETHYLHEXADECANOIC ACID METHYL ESTER structure
|
Common Name | 3,7,11,15-TETRAMETHYLHEXADECANOIC ACID METHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 1118-77-0 | Molecular Weight | 326.55700 | |
| Density | 0.858g/cm3 | Boiling Point | 346.1ºC at 760 mmHg | |
| Molecular Formula | C21H42O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 174ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 3,7,11,15-TETRAMETHYLHEXADECANOIC ACID METHYL ESTERPhytanic acid methyl ester, an esterified form of long-chain fatty acid methyl esters and phytanic acid, has been found in Greek tobacco. 1 1. Kimland, B., Aasen, AJ and Enzell, CRTobacco chemistry. 10. Volatile neutral constituents of Hellenic Acta Tobacco Chemistry. Scand.26(6)2177-2184(1972) |
| Name | Phytanic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Phytanic acid methyl ester, an esterified form of long-chain fatty acid methyl esters and phytanic acid, has been found in Greek tobacco. 1 1. Kimland, B., Aasen, AJ and Enzell, CRTobacco chemistry. 10. Volatile neutral constituents of Hellenic Acta Tobacco Chemistry. Scand.26(6)2177-2184(1972) |
|---|---|
| Related Catalog |
| Density | 0.858g/cm3 |
|---|---|
| Boiling Point | 346.1ºC at 760 mmHg |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.55700 |
| Flash Point | 174ºC |
| Exact Mass | 326.31800 |
| PSA | 26.30000 |
| LogP | 6.62470 |
| Vapour Pressure | 5.88E-05mmHg at 25°C |
| Index of Refraction | 1.443 |
| InChIKey | LAWJUFPULQZGLF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Phytol/Phytanic acid and insulin resistance: potential role of phytanic acid proven by docking simulation and modulation of biochemical alterations.
PLoS ONE 8(1) , e45638, (2013) Since activation of PPARγ is the main target for the antidiabetic effect of TZDs, especially when it heterodimerizes with RXR, we aimed to test the potential antidiabetic effect of phytol (250 mg/kg),... |
| Methyl 3,7,11,15-tetramethylhexadecanoate |
| 3,7,11,15-Tetramethylhexadecanoic acid methyl ester |
| MFCD00214370 |