(R)-N-(tert-Butyl)-3-(4-(2-methoxyphenyl)piperazin-1-yl)-2-phenylpropanamide
Modify Date: 2025-08-29 17:42:09
(R)-N-(tert-Butyl)-3-(4-(2-methoxyphenyl)piperazin-1-yl)-2-phenylpropanamide structure
|
Common Name | (R)-N-(tert-Butyl)-3-(4-(2-methoxyphenyl)piperazin-1-yl)-2-phenylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 133025-52-2 | Molecular Weight | 395.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-N-(tert-Butyl)-3-(4-(2-methoxyphenyl)piperazin-1-yl)-2-phenylpropanamide |
|---|
| Molecular Formula | C24H33N3O2 |
|---|---|
| Molecular Weight | 395.5 |
| InChIKey | UMTDAKAAYOXIKU-FQEVSTJZSA-N |
| SMILES | COc1ccccc1N1CCN(CC(C(=O)NC(C)(C)C)c2ccccc2)CC1 |
|
Name: In vitro binding affinity towards the noradrenergic beta receptor at 10 e-6 M
Source: ChEMBL
Target: Beta-3 adrenergic receptor
External Id: CHEMBL845075
|
|
Name: In vitro binding affinity towards the 5-hydroxytryptamine 1C receptor at 10 e-6 M
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2C
External Id: CHEMBL616826
|
|
Name: In vitro binding affinity towards the dopamine receptor D1 at 10 e-6 M
Source: ChEMBL
Target: D(1A) dopamine receptor
External Id: CHEMBL672027
|
|
Name: In vitro binding affinity towards the dopamine receptor D2 at 10 e-6 M
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL675821
|
|
Name: In vitro binding affinity towards the 5-hydroxytryptamine 2 receptor at 10 e-6 M
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 2B
External Id: CHEMBL617551
|
|
Name: In vitro binding affinity towards the noradrenergic alpha-2 receptor at 10 e-6 M
Source: ChEMBL
Target: Alpha-2A adrenergic receptor
External Id: CHEMBL845073
|
|
Name: In vitro binding affinity towards the 5-hydroxytryptamine 1B receptor at 10 e-6 M
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 1B
External Id: CHEMBL616760
|
Total 7, Current Page 1 of 1
1