3,6-Dihydroxy-N-(2-hydroxyphenyl)-2-naphthalenecarboxamide
Modify Date: 2025-10-16 00:25:59
3,6-Dihydroxy-N-(2-hydroxyphenyl)-2-naphthalenecarboxamide structure
|
Common Name | 3,6-Dihydroxy-N-(2-hydroxyphenyl)-2-naphthalenecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 265309-09-9 | Molecular Weight | 295.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-Dihydroxy-N-(2-hydroxyphenyl)-2-naphthalenecarboxamide |
|---|
| Molecular Formula | C17H13NO4 |
|---|---|
| Molecular Weight | 295.29 |
| InChIKey | QRBXLPMZDZGMCY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1O)c1cc2ccc(O)cc2cc1O |
|
Name: Inhibition of human purified recombinant pp60c-src tyrosine kinase
Source: ChEMBL
Target: Proto-oncogene tyrosine-protein kinase Src
External Id: CHEMBL823239
|
|
Name: Inhibition of human purified recombinant pp60c-src tyrosine kinase at 100 uM
Source: ChEMBL
Target: Proto-oncogene tyrosine-protein kinase Src
External Id: CHEMBL823857
|
Total 2, Current Page 1 of 1
1