3-Carboxamido coumarin, 38 structure
|
Common Name | 3-Carboxamido coumarin, 38 | ||
|---|---|---|---|---|
| CAS Number | 326884-01-9 | Molecular Weight | 279.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Carboxamido coumarin, 38 |
|---|
| Molecular Formula | C17H13NO3 |
|---|---|
| Molecular Weight | 279.29 |
| InChIKey | JRUWEFVSUSZZHI-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1cc2ccccc2oc1=O)c1ccccc1 |
|
Name: MAO Enzyme Inhibition Assay from Article 10.1021/jm801496u: "Synthesis, molecular mod...
Source: BindingDB
Target: N/A
External Id: BindingDB_3190_1
|
|
Name: Selectivity index, ratio of IC50 for human recombinant MAOA to IC50 for human recombi...
Source: ChEMBL
Target: N/A
External Id: CHEMBL964046
|
|
Name: Inhibition of human recombinant MAOA expressed in BTI-TN-5B1-4 cells assessed as effe...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL964043
|
|
Name: Inhibition of human recombinant MAOB expressed in BTI-TN-5B1-4 cells assessed as effe...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL964042
|