4-(Trifluoromethyl)hydrocinnamic acid structure
|
Common Name | 4-(Trifluoromethyl)hydrocinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 53473-36-2 | Molecular Weight | 218.173 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 279.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O2 | Melting Point | 106-110 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 122.6±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-[4-(Trifluoromethyl)phenyl]propionic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.0±35.0 °C at 760 mmHg |
| Melting Point | 106-110 °C(lit.) |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.173 |
| Flash Point | 122.6±25.9 °C |
| Exact Mass | 218.055466 |
| PSA | 37.30000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | OEIUMLSCWINLBB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~94%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: Quinn, John F.; Razzano, Dana A.; Golden, Kathryn C.; Gregg, Brian T. Tetrahedron Letters, 2008 , vol. 49, # 42 p. 6137 - 6140 |
|
~99%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: ACTELION PHARMACEUTICALS LTD; ERBECK, Silke; KOBERSTEIN, Ralf; SOI, Antonio; ZISTLER, Andrea Patent: WO2010/64212 A1, 2010 ; Location in patent: Page/Page column 23 ; |
|
~94%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: Lemhadri, Mhamed; Doucet, Henri; Santelli, Maurice Tetrahedron, 2004 , vol. 60, # 50 p. 11533 - 11540 |
|
~83%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: Vautravers, Nicolas R.; Breit, Bernhard Synlett, 2011 , # 17 p. 2517 - 2520 |
|
~%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: Tetrahedron, , vol. 63, # 2 p. 389 - 395 |
|
~%
4-(Trifluoromet... CAS#:53473-36-2 |
| Literature: Tetrahedron, , vol. 63, # 2 p. 389 - 395 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
3-[4-(Trifluoromethyl) phenyl] propanoic acid. Guan J-N, et al.
Acta Crystallogr. Sect. E Struct. Rep. Online 65(4) , o844, (2009)
|
| MFCD00674032 |
| QV2R DXFFF |
| 3-(4-(Trifluoromethyl)phenyl)propanoic acid |
| 4-(Trifluoromethyl)hydrocinnamic acid |
| 3-[4-(Trifluoromethyl)phenyl]propionic acid |
| 4-(Trifluoromethyl)benzenepropanoic acid |
| 3-[4-(Trifluoromethyl)phenyl]propanoic acid |