dimethyl 2-aminoisophthalate structure
|
Common Name | dimethyl 2-aminoisophthalate | ||
|---|---|---|---|---|
| CAS Number | 57053-02-8 | Molecular Weight | 209.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-aminobenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO4 |
|---|---|
| Molecular Weight | 209.19900 |
| Exact Mass | 209.06900 |
| PSA | 78.62000 |
| LogP | 1.42320 |
| InChIKey | QVBQPOJYBWWILD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1N |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-1,3-benzenedicarboxylic acid,dimethyl ester |
| dimethyl 2-aminoisophtalate |
| 1,3-Benzenedicarboxylic acid,2-amino-,dimethyl ester |
| dimethyl 2-aminoisophthalate |
| 2-amino-isophthalic acid dimethyl ester |
| 2-Amino-isophthalsaeure-dimethylester |
| aminoisophthalic acid dimethyl ester |
| dimethyl 2-amino-1,3-benzenedicarboxylate |