(Z)-2-(5-((5-(2-fluorophenyl)furan-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)acetic acid
Modify Date: 2026-03-23 18:54:03
(Z)-2-(5-((5-(2-fluorophenyl)furan-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)acetic acid structure
|
Common Name | (Z)-2-(5-((5-(2-fluorophenyl)furan-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 883473-74-3 | Molecular Weight | 363.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10FNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-2-(5-((5-(2-fluorophenyl)furan-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)acetic acid |
|---|
| Molecular Formula | C16H10FNO4S2 |
|---|---|
| Molecular Weight | 363.4 |
| InChIKey | UIHHFGAFGCMKOT-QPEQYQDCSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)/C=C\3/C(=O)N(C(=S)S3)CC(=O)O)F |
|
Name: Inhibition of human ASK1 using MBP as substrate incubated for 10 mins prior to ATP ad...
Source: ChEMBL
Target: Mitogen-activated protein kinase kinase kinase 5
External Id: CHEMBL2352238
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 2, Current Page 1 of 1
1