| Identification | Back Directory |  [Name]
  TYRPHOSTIN AG 1290 |  [CAS]
  160391-70-8 |  [Synonyms]
  AG1290 AG-1290 AG 1290 Entacapone acid TYRPHOSTIN AG 1290 Entacapone impurity F XDDDOLQEZBJWFZ-LZCJLJQNSA-N (2E)-2-Cyano-3-(3,4-dihydroxy-5-nit Entacapone Impurity 6(Entacapone EP Impurity F) Entacapone Impurity 6(Entacapone EP Impurity A) Entacapone Impurity 22(Entacapone EP Impurity F) (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoic acid 2-Propenoic acid, 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-, (2E)- |  [Molecular Formula]
  C10H6N2O6 |  [MDL Number]
  MFCD16170433 |  [MOL File]
  160391-70-8.mol |  [Molecular Weight]
  250.16 |  
 | Chemical Properties | Back Directory |  [Boiling point ]
  478.9±45.0 °C(Predicted) |  [density ]
  1.744±0.06 g/cm3(Predicted) |  [form ]
  Yellow to green solid. |  [pka]
  0.51±0.10(Predicted) |  [InChI]
  InChI=1S/C10H6N2O6/c11-4-6(10(15)16)1-5-2-7(12(17)18)9(14)8(13)3-5/h1-3,13-14H,(H,15,16)/b6-1+ |  [InChIKey]
  XDDDOLQEZBJWFZ-LZCJLJQNSA-N |  [SMILES]
  C(O)(=O)/C(/C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |  
 | Hazard Information | Back Directory |  [Uses]
  Entacapone Acid, is the acid derivative of Entacapone (E558500). (E)-Isomer of Entacapone polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian. |  
  
             | 
            
                
                
                
                
                
                
                
                
                
                    
                        
                            | Company Name: | 
                            
                                Spectrum Chemical Manufacturing Corp.  
                             | 
                         
                        
                            | Tel: | 
                            021-021-021-67601398-809-809-809 15221380277 | 
                         
                        
                            | Website: | 
                            www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us | 
                         
                    
                 
                
                
                
                
                    
                        
                            | Company Name: | 
                            
                                BOC Sciences  
                             | 
                         
                        
                            | Tel: | 
                             16314854226 | 
                         
                        
                            | Website: | 
                            www.bocsci.com | 
                         
                    
                 
                
                
                
                
                
                    
                        
                            | Company Name: | 
                            
                                TOSUN PHARM  
                             | 
                         
                        
                            | Tel: | 
                            020-61855200 13326451905 | 
                         
                        
                            | Website: | 
                            www.toref.cn/ | 
                         
                    
                 
                
             |