| Identification | Back Directory | [Name]
2-(2-BroMophenyl)-9H-phenylcarbazole | [CAS]
1616607-88-5 | [Synonyms]
2-(2-Bromophenyl)-9-phenylcarbazole 2-(2-BroMophenyl)-9H-phenylcarbazole 9H-Carbazole, 2-(2-bromophenyl)-9-phenyl- | [Molecular Formula]
C24H16BrN | [MDL Number]
MFCD27644694 | [MOL File]
1616607-88-5.mol | [Molecular Weight]
398.29 |
| Chemical Properties | Back Directory | [Melting point ]
104.0 to 108.0 °C | [Boiling point ]
550.1±32.0 °C(Predicted) | [density ]
1.32±0.1 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [color ]
White to Light yellow | [InChI]
InChI=1S/C24H16BrN/c25-22-12-6-4-10-19(22)17-14-15-21-20-11-5-7-13-23(20)26(24(21)16-17)18-8-2-1-3-9-18/h1-16H | [InChIKey]
DUNRZHFGIQTWFF-UHFFFAOYSA-N | [SMILES]
N1(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=C(C1=CC=CC=C1Br)C=C2 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
http://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
http://www.tcichemicals.com/en/us/index.html |
|