|
|
| | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde Basic information |
| Product Name: | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde | | Synonyms: | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde;tert-butyl 9-formyl-3-azaspiro[5.5]undecane-3-carboxylate;3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde - A10745;3-Boc-9-formyl-3-azaspiro[5.5]undecane;3-Azaspiro[5.5]undecane-3-carboxylic acid, 9-formyl-, 1,1-dimethylethyl ester | | CAS: | 1416176-14-1 | | MF: | C16H27NO3 | | MW: | 281.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1416176-14-1.mol | ![3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde Structure](CAS/20150408/GIF/1416176-14-1.gif) |
| | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde Chemical Properties |
| Boiling point | 385.8±42.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | form | Solid-Liquid Mixture | | pka | -0.92±0.40(Predicted) | | color | Colorless to off-white | | InChI | InChI=1S/C16H27NO3/c1-15(2,3)20-14(19)17-10-8-16(9-11-17)6-4-13(12-18)5-7-16/h12-13H,4-11H2,1-3H3 | | InChIKey | AXUPGUGFMSYTMC-UHFFFAOYSA-N | | SMILES | C1C2(CCC(C=O)CC2)CCN(C(OC(C)(C)C)=O)C1 |
| Storage Class | 11 - Combustible Solids |
| | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde Usage And Synthesis |
| Uses | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde is a PROTAC linker, and can be used for synthesis of PROTAC SOS1 degrader-8 (HY-161634)[1]. | | References | [1] Ye Zhengqing, et al. Sos1 protein degradation agent and use thereof. Patent. WO2024083257A1 |
| | 3-Boc-3-azaspiro[5.5]undecane-9-carbaldehyde Preparation Products And Raw materials |
|