|
|
| | Methyl cyclohexylphenylglycolate Basic information |
| | Methyl cyclohexylphenylglycolate Chemical Properties |
| Melting point | 40 °C | | Boiling point | 170-175 °C(Press: 9 Torr) | | density | 1.130±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 12.19±0.29(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C15H20O3/c1-18-14(16)15(17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-5,8-9,13,17H,3,6-7,10-11H2,1H3 | | InChIKey | SPTZOODMHSABLY-UHFFFAOYSA-N | | SMILES | O(C)C(=O)C(O)(C2CCCCC2)c1ccccc1 | | CAS DataBase Reference | 10399-13-0(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2918191350 | | Storage Class | 13 - Non Combustible Solids |
| | Methyl cyclohexylphenylglycolate Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | Methyl 2-Cyclohexyl-2-hydroxyphenylacetate is an impurity of Oxybutynin (O868525). |
| | Methyl cyclohexylphenylglycolate Preparation Products And Raw materials |
|