| Company Name: |
Yichang Zhongyitai Trading Co., Ltd. Gold
|
| Tel: |
0717-6449896 13886658719 |
| Email: |
root@zhongyitai.com |
| Products Intro: |
Product Name:8(Z),11(Z),14(Z),17(Z)-Octadecatetraenoic Acid Ethyl Ester
CAS:2580285-53-4
Purity:溶剂型，98+%，5mg/瓶 Remarks:25mg
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:(8Z,11Z,14Z)-Ethyl Octadeca-8,11,14,17-Tetraenoate
CAS:2580285-53-4
Purity:95% HPLC Package:10mg;25mg;50mg
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:IPA（C18:4n-1 ee）
CAS:2580285-53-4
Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
|
| | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate Basic information |
| Product Name: | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate | | Synonyms: | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate;8(Z),11(Z),14(Z),17(Z)-Octadecatetraenoic Acid Ethyl Ester;Eicosapentaenoic Acid Impurity 28;8,11,14,17-Octadecatetraenoic acid, ethyl ester, (8Z,11Z,14Z)-;Tolterodine Impurity 30;IPA（C18:4n-1 ee） | | CAS: | 2580285-53-4 | | MF: | C20H32O2 | | MW: | 304.47 | | EINECS: | | | Product Categories: | | | Mol File: | 2580285-53-4.mol |  |
| | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate Chemical Properties |
| Boiling point | 387.3±21.0 °C(Predicted) | | density | 0.900±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C20H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h3,6-7,9-10,12-13H,1,4-5,8,11,14-19H2,2H3/b7-6-,10-9-,13-12- | | InChIKey | CYYNBKZVOBNFIP-QNEBEIHSSA-N | | SMILES | C(OCC)(=O)CCCCCC/C=C\C/C=C\C/C=C\CC=C |
| | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate Usage And Synthesis |
| Uses | Ethyl (8Z,11Z,14Z)-octadeca-8,11,14,17-tetraenoate (8(Z),11(Z),14(Z),17(Z)-Octadecatetraenoic acid ethyl ester) is an ester product. |
| | (8Z,11Z,14Z)-ethyl octadeca-8,11,14,17-tetraenoate Preparation Products And Raw materials |
|