| Name | 4-Amino-5-bromo-2-chloropyridine |
| Synonyms | 111548 5-Bromo-2-chloropyridin-4-amine 5-Bromo-2-chloro-4-pyridinamine 4-Amino-5-bromo-2-chloropyridine 2-Chloro-5-bromo-4-aminopyridine 4-AMINO-5-BROMO-2-CHLOROPYRIDINE 4-Pyridinamine, 5-bromo-2-chloro- 4-pyridinamine, 5-bromo-2-chloro- 5-Bromo-2-chloro-pyridin-4-ylamine 2-CHLORO-5-BROMO-PYRIDINE-4-YLAMINE |
| CAS | 857730-21-3 |
| InChI | InChI=1/C5H4BrClN2/c6-3-2-9-5(7)1-4(3)8/h1-2H,(H2,8,9) |
| InChIKey | MGZWZNBANVSZLM-UHFFFAOYSA-N |
| Molecular Formula | C5H4BrClN2 |
| Molar Mass | 207.46 |
| Density | 1.834±0.06 g/cm3(Predicted) |
| Melting Point | 127.3-128.4 °C |
| Boling Point | 315.5±37.0 °C(Predicted) |
| Flash Point | 144.59°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 2.73±0.42(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.648 |
| Hazard Symbols | T - Toxic![]() |
| Risk Codes | R25 - Toxic if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
| Packing Group | III |
| Application | 4-amino-5-bromo-2-chloropyridine is an intermediate in organic synthesis and a pharmaceutical intermediate, can be used in laboratory research and development process and chemical and pharmaceutical synthesis process. |