7-O-Methylrosmanol structure
|
Common Name | 7-O-Methylrosmanol | ||
|---|---|---|---|---|
| CAS Number | 113085-62-4 | Molecular Weight | 360.444 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 542.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H28O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 189.7±23.6 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of 7-O-Methylrosmanol7-Methoxyrosmanol (7-O-Methoxyrosmanol), a phenolic diterpene isolated from rosemary, suppresses the cAMP responsiveness of PEPCK and G6Pase promoters[1]. |
| Name | (4bR,8aS,9S,10S)-3,4-dihydroxy-2-isopropyl-10-methoxy-8,8-dimethyl-6,7,8,8a,9,10-hexahydro-5H-9,4b-(epoxymethano)phenanthren-12-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Methoxyrosmanol (7-O-Methoxyrosmanol), a phenolic diterpene isolated from rosemary, suppresses the cAMP responsiveness of PEPCK and G6Pase promoters[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.3±50.0 °C at 760 mmHg |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.444 |
| Flash Point | 189.7±23.6 °C |
| Exact Mass | 360.193665 |
| PSA | 75.99000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | XNPVHIQPSAZTLC-NYUBLWNDSA-N |
| SMILES | COC1c2cc(C(C)C)c(O)c(O)c2C23CCCC(C)(C)C2C1OC3=O |
| Storage condition | ?20°C |
| (6β,7α)-11,12-Dihydroxy-7-methoxy-6,20-epoxyabieta-8(14),9(11),12-trien-20-one |