5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine
|
|
|
- CAS-Nr.
- 1262412-30-5
- Englisch Name:
- 5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine
- Synonyma:
- 5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine;Pyridine, 5-bromo-3-fluoro-2-(trifluoromethyl)-
- CBNumber:
- CB72554522
- Summenformel:
- C6H2BrF4N
- Molgewicht:
- 243.98
- MOL-Datei:
- 1262412-30-5.mol
|
5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine Eigenschaften
- Siedepunkt:
- 172.6±35.0 °C(Predicted)
- Dichte
- 1.786±0.06 g/cm3(Predicted)
- storage temp.
- Storage temp. 2-8°C
- pka
- -4.24±0.32(Predicted)
- Aggregatzustand
- solid
- Aussehen
- Colorless to light yellow Liquid
- InChI
- 1S/C6H2BrF4N/c7-3-1-4(8)5(12-2-3)6(9,10)11/h1-2H
- InChIKey
- ZYPJKTSNQGVERF-UHFFFAOYSA-N
- SMILES
- FC1=C(C(F)(F)F)N=CC(Br)=C1
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
T |
|
|
| R-Sätze: |
25 |
|
|
| S-Sätze: |
45 |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
9999999999 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizität oral |
Kategorie 3 |
Achtung |
 |
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 43)Lieferanten
- 5-Bromo-3-fluoro-2-(trifluoromethyl)pyridine
- Pyridine, 5-bromo-3-fluoro-2-(trifluoromethyl)-
- 1262412-30-5