아세틸테트라펩타이드-11
|
|
아세틸테트라펩타이드-11 속성
- 시퀀스
- Ac-Pro-Pro-Tyr-Leu
- InChIKey
- KQEQPUBSXXOUGC-MLCQCVOFSA-N
- SMILES
- C(O)(=O)[C@H](CC(C)C)NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(C)=O
안전
아세틸테트라펩타이드-11 C화학적 특성, 용도, 생산
개요
Acetyltetrapeptide 11 is a synthetic peptide produced by the acetylation of tetrapeptide-11 (a chemical reaction that joins a stronger substance to a weaker one) and consists of the amino acids leucine, proline and tyrosine. Acetyl tetrapeptide-11 helps skin become healthier by interacting with signalling proteins on the surface of the skin to address the look and feel of the skin.아세틸테트라펩타이드-11 준비 용품 및 원자재
원자재
준비 용품
아세틸테트라펩타이드-11 공급 업체
글로벌( 129)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| GIHI CHEMICALS CO.,LIMITED | +8618058761490 |
info@gihichemicals.com | China | 49941 | 58 |
| Shaanxi TNJONE Pharmaceutical Co., Ltd | +8618092446649 |
sarah@tnjone.com | China | 1143 | 58 |
| Wuhan Haorong Biotechnology Co.,ltd | +8618565342920 |
sales@chembj.net | China | 301 | 58 |
| Chongqing Zhihe Biopharmaceutical Co., Ltd. | +86-18580541567 +86-17782035140 |
sales@zhswyy.com | China | 240 | 58 |
| Shanghai Getian Industrial Co., LTD | +86-15373193816 |
mike@ge-tian.com | China | 269 | 58 |
| ZHENGZHOU JIUYI TIME NEW MATERIALS CO,.LTD | +86-13017695106 +86-13676922317 |
jiuyitime@fdachem.com | China | 16513 | 58 |
| Chengdu Shengnuo Biopharm Co.,Ltd | +8613953333566 |
sinobiopharm@gmail.com | China | 71 | 58 |
| Adachibio Inc. | +81-8027837258; +8108027837258 |
sales@adachibio.com | Japan | 992 | 58 |
| Shenzhen Nexconn Pharmatechs Ltd | +86-755-89396905 +86-15013857715 |
admin@nexconn.com | China | 10405 | 58 |
| BOC Sciences | +1-631-485-4226 |
inquiry@bocsci.com | United States | 19552 | 58 |
아세틸테트라펩타이드-11 관련 검색:
아세틸테트라펩타이드-9 아세틸테트라펩타이드15 N2-아세틸-L-리실글리실-L-히스티딜-L-리신아미드 N2-아세틸-L-라이실-L-알파-아스파르실-L-발릴-L-티로신 N-아세틸-베타-알라닐-L-히스티딜-L-세릴-L-히스티딘 히스티딜-아르기닐-알라닐-트립토필-페닐알라닐-리신아마이드 N-아세틸-L-노를류실-L-알라닐-L-히스티딜-D-페닐알라닐-L-아르기닐-L-트립토판아미드 GLY-HIS-LYS아세테이트소금 L-카노신
Tripeptide-10 citrulline
AC-DMQD-CHO
Acetyl tetrapeptide-3
Acetyl Decapeptide-3
ACETYL PENTAPEPTIDE-1
Acetyl Tetrapeptide-40
Acety Tetrapeptide-22
Acetyl Hexapeptide-37
Argireline




