- cis-3-Hexen-1-yl Crotonate
-
- $15.00 / 1KG
-
2021-07-02
- CAS:65405-80-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | CROTONIC ACID CIS-3-HEXEN-1-YL ESTER Basic information | | Aroma |
| | CROTONIC ACID CIS-3-HEXEN-1-YL ESTER Chemical Properties |
| Boiling point | 107 °C25 mm Hg(lit.) | | density | 0.91 g/mL at 25 °C(lit.) | | FEMA | 3982 | (Z)-3-HEXENYL (E)-2-BUTENOATE | | refractive index | n20/D 1.455(lit.) | | Fp | 202 °F | | Odor | at 100.00 %. green vegetable | | Odor Type | green | | biological source | synthetic | | JECFA Number | 1276 | | Major Application | flavors and fragrances | | InChI | 1S/C10H16O2/c1-3-5-6-7-9-12-10(11)8-4-2/h4-6,8H,3,7,9H2,1-2H3/b6-5-,8-4+ | | InChIKey | KITGYVIOYOCIIE-QNMAEOQASA-N | | SMILES | [H]\C(C)=C(\[H])C(=O)OCC\C([H])=C(\[H])CC | | LogP | 3.65 | | CAS DataBase Reference | 65405-80-3 | | EPA Substance Registry System | 2-Butenoic acid, (3Z)-3-hexenyl ester, (2E)- (65405-80-3) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | CROTONIC ACID CIS-3-HEXEN-1-YL ESTER Usage And Synthesis |
| Aroma | Powerful, dry-green odor with floral undertones. | | Physical properties | Colorless liquid. Practically insoluble in water,
soluble in alcohol and oils. | | Production Methods | Crotonic acid cis-3-hexen-1-yl ester, produced by very few perfume
chemical manufacturers only, has been suggested for use in floral fragrances as a naturalgrcen topnotc item. | | Occurrence | Reportedly found in wine, fresh mango (Magnifera indica L.) and Curuba (banana passion fruit, Passiflora
mollissima) | | Uses | flavors and fragrances | | Aroma threshold values | Detection at 0.32 ppm (water). |
| | CROTONIC ACID CIS-3-HEXEN-1-YL ESTER Preparation Products And Raw materials |
|