|
|
| | BZ-TYR-PNA Basic information |
| | BZ-TYR-PNA Chemical Properties |
| Melting point | 235-237 °C | | Boiling point | 776.8±60.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 9.87±0.15(Predicted) | | color | white | | InChI | 1S/C22H19N3O5/c26-19-12-6-15(7-13-19)14-20(24-21(27)16-4-2-1-3-5-16)22(28)23-17-8-10-18(11-9-17)25(29)30/h1-13,20,26H,14H2,(H,23,28)(H,24,27) | | InChIKey | CJERUMAUMMIPRF-UHFFFAOYSA-N | | SMILES | Oc1ccc(CC(NC(=O)c2ccccc2)C(=O)Nc3ccc(cc3)[N+]([O-])=O)cc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BZ-TYR-PNA Usage And Synthesis |
| Uses | N-Benzoyl-L-tyrosine p-nitroanilide (BTPNA) is used as a substrate to identify, differentiate and characterize serine carboxypeptidase(s) and various proteases. |
| | BZ-TYR-PNA Preparation Products And Raw materials |
|