|
|
| | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI) Basic information |
| Product Name: | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI) | | Synonyms: | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI);6-Chloro-2-MethylpyriMidin-4(1H)-one;6-Chloro-2-MethylpyriMidin-4-ol;4-Chloro-6-hydroxy-2-methylpyrimidine;6-Chloro-2-methylpyrimidin-4-ol, 4-Chloro-6-hydroxy-2-methyl-1,3-diazine;6-chloro-2-methyl-1H-pyrimidin-4-one;6-Chloro-2-methylpyrimidin-4(1H);4(1H)-Pyrimidinone, 6-chloro-2-methyl- | | CAS: | 17551-52-9 | | MF: | C5H5ClN2O | | MW: | 144.56 | | EINECS: | | | Product Categories: | PYRIMIDINE | | Mol File: | 17551-52-9.mol |  |
| | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI) Chemical Properties |
| Melting point | 233-236° | | Boiling point | 205.4±50.0 °C(Predicted) | | density | 1.60 g/cm3 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | 7.33±0.50(Predicted) | | color | White | | InChI | InChI=1S/C5H5ClN2O/c1-3-7-4(6)2-5(9)8-3/h2H,1H3,(H,7,8,9) | | InChIKey | QNANRGHPXMUJQC-UHFFFAOYSA-N | | SMILES | C1(C)NC(Cl)=CC(=O)N=1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933599590 |
| | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI) Usage And Synthesis |
| Uses | 6-Chloro-4-hydroxy-2-methylpyrimidine is an intermediate used to prepare highly potent hepatitis C Virus entry inhibitors. It is also used in the synthesis of pyrimidineacetic acids and (Pyrimidinyloxy)acetic acids as aldose reductase inhibitors. |
| | 4(1H)-Pyrimidinone, 6-chloro-2-methyl- (9CI) Preparation Products And Raw materials |
|