|
|
| | Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate Basic information |
| Product Name: | Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate | | Synonyms: | N-BENZYL-4-CARBETHOXY-3-PIPERIDONE;N-Benzyl-3-oxo-4-piperidinecarboxylate;1-BENZYL-3-OXO-PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER;ETHYL N-BENZYL-3-KETOPIPERIDINE-4-CARBOXYLATE;ethyl 1-benzyl-3-oxopiperidine-4-carboxylate;3-Oxo-1-(phenylmethyl)-4-piperidinecarboxylic acid ethyl ester;3-Oxo-1-phenylmethyl-4-piperidinecarboxylic acid ethyl ester;4-piperidinecarboxylic acid, 3-oxo-1-(phenylmethyl)-, ethyl ester | | CAS: | 39514-19-7 | | MF: | C15H19NO3 | | MW: | 261.32 | | EINECS: | 254-482-4 | | Product Categories: | | | Mol File: | 39514-19-7.mol |  |
| | Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate Chemical Properties |
| Boiling point | 368.6±42.0 °C(Predicted) | | density | 1.154 | | refractive index | 1.544 | | storage temp. | 2-8°C | | pka | 10.85±0.20(Predicted) | | Appearance | Yellow to reddish brown Liquid | | InChI | InChI=1S/C15H19NO3/c1-2-19-15(18)13-8-9-16(11-14(13)17)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 | | InChIKey | JYFGIESQUYQLGM-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(C(OCC)=O)C(=O)C1 | | LogP | 1.680 (est) |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate Usage And Synthesis |
| Uses | The microbial reduction of ethyl 1-benzyl-3-oxopiperidine-4-carboxylate could be used to make the ethyl cis-(3R,4R)-1-benzyl-3R-hydroxypiperidine-4R-carboxylate in high diastereomeric and enantiomeric excess[1].
| | References | [1] Zhiwei Guo. “Stereospecific microbial reduction of ethyl 1-benzyl-3-oxo-piperidine-4-carboxylate.” Tetrahedron, asymmetry 17 13 (2006): Pages 2015-2020. |
| | Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate Preparation Products And Raw materials |
| Preparation Products | 3-Oxo-Piperidine-1,4-Dicarboxylic Acid 1-Tert-Butyl Ester 4-Ethyl Ester-->ethyl 1-benzyl-3-oxopiperidine-4-carboxylate hydrochloride-->7-BENZYL-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE-2,4(1H,3H)-DIONE-->7-BENZYL-5,6,7,8-TETRAHYDRO4-CHLORO-PYRIDO[3,4-D]PYRIMIDINE HYDROCHLORIDE-->1-Benzyl-3-piperidone-->1-benzyl-4-(hydroxymethyl)piperidin-3-ol-->1-tert-butyl 4-ethyl 3-oxopiperidine-1,4-dicarboxylate |
|