|
|
| | 2-Trifluoromethyl thioxanthone Basic information |
| | 2-Trifluoromethyl thioxanthone Chemical Properties |
| Melting point | 147-151 °C(lit.) | | Boiling point | 375.1±42.0 °C(Predicted) | | density | 1.433±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Crystalline | | color | Pale yellow | | Sensitive | Light Sensitive | | InChI | InChI=1S/C14H7F3OS/c15-14(16,17)8-5-6-12-10(7-8)13(18)9-3-1-2-4-11(9)19-12/h1-7H | | InChIKey | NEWRXGDGZGIHIS-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)SC2=C1C=C(C(F)(F)F)C=C2 | | CAS DataBase Reference | 1693-28-3(CAS DataBase Reference) | | NIST Chemistry Reference | 9H-thioxanthen-9-one, 2-(trifluoromethyl)-(1693-28-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 2-Trifluoromethyl thioxanthone Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | 2-Trifluoromethylthioxanthone is a decomposition product of the dopamine receptor antagonist and antipsychotic agent Flupentixol (F598050). |
| | 2-Trifluoromethyl thioxanthone Preparation Products And Raw materials |
|