- L-Ornithine 2-Oxoglutarate
-
- $10.00 / 1Kg/Bag
-
2025-04-16
- CAS:5144-42-3
- Min. Order: 1KG
- Purity: 99% HPLC,USP Standard
- Supply Ability: 1000KGs
|
| | L-Ornithine 2-oxoglutarate Basic information |
| Product Name: | L-Ornithine 2-oxoglutarate | | Synonyms: | L-Ornithine α-Ketoglutarate Monohydrate;L-ORNITHINE-KETOGLUTARATE DIHYDRATE;L-ORNITHINE A-KETOGLUTARATE (2:1);L-ORNITHINE-A-KETOGLUTARATE(2:1) DIHYDRATE;L-ORNITHINE ALPHA-KETOGLUTARATE (2:1) DIHYDRATE;Ornithine α-ketoglutaric acid;Ornithine/α-ketoglutaric acid,(2:1);(2S)-2,5-bis(azanyl)pentanoic acid | | CAS: | 5144-42-3 | | MF: | C10H18N2O7 | | MW: | 278.26 | | EINECS: | 225-914-9 | | Product Categories: | Food Additives;Amino Acids;Nutritional Supplements | | Mol File: | 5144-42-3.mol |  |
| | L-Ornithine 2-oxoglutarate Chemical Properties |
| InChI | InChI=1/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/s3 | | InChIKey | SLPUVFBNQHVEEU-NDILARRWNA-N | | SMILES | C(CC(=O)O)C(=O)C(=O)O.C(CCN)[C@H](N)C(=O)O |&1:14,r| | | CAS DataBase Reference | 5144-42-3(CAS DataBase Reference) |
| | L-Ornithine 2-oxoglutarate Usage And Synthesis |
| | L-Ornithine 2-oxoglutarate Preparation Products And Raw materials |
|