|
|
| | CHOLESTANE-3β,5α,6β-TRIOL Basic information |
| Product Name: | CHOLESTANE-3β,5α,6β-TRIOL | | Synonyms: | 5-alpha,6-beta-dihydroxycholestanol;5-alpha-cholestane-3-beta,5,6-beta-triol;6-triol,(3-beta,5-alpha,6-beta)-cholestane-5;cholestane-3-beta,5-alpha,6-beta-triol;CHOLESTANTRIOL;Cholestane-3B,5ALPHA,6B-triol;3β,5α,6β-Trihydroxycholestane;5α-Cholestane-3β,5,6β-triol | | CAS: | 1253-84-5 | | MF: | C27H48O3 | | MW: | 420.67 | | EINECS: | | | Product Categories: | Aliphatics | | Mol File: | 1253-84-5.mol |  |
| | CHOLESTANE-3β,5α,6β-TRIOL Chemical Properties |
| Melting point | 226-231°C | | Boiling point | 515.7±40.0 °C(Predicted) | | density | 1.065±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Methanol (Slightly) | | pka | 14.26±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | YMMFNKXZULYSOQ-RUXQDQFYSA-N | | SMILES | O[C@]21[C@@]([C@@H]3[C@H]([C@H]4[C@@]([C@H](CC4)[C@@H](CCCC(C)C)C)(CC3)C)C[C@H]2O)(CC[C@@H](C1)O)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-68/20/21/22 | | Safety Statements | 36 | | WGK Germany | 1 | | RTECS | FZ6275000 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intraperitoneal,130mg/kg (130mg/kg),BEHAVIORAL: MUSCLE WEAKNESSGASTROINTESTINAL: "HYPERMOTILITY, DIARRHEA",Japanese Journal of Pharmacology. Vol. 17, Pg. 340, 1967. |
| | CHOLESTANE-3β,5α,6β-TRIOL Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Cholesterol analog. Useful for treatment of hyperlipemia, arteriosclerosis, diabetes, obesity. | | Uses | Cholesterol analog. Cholestane-3β,5α,6β-Triol is useful for treatment of hyperlipemia, arteriosclerosis, diabetes, obesity. | | Definition | ChEBI: 5alpha-cholestane-3beta,5,6beta-triol is a 3beta-hydroxy steroid, a 6beta-hydroxy steroid and a 5alpha-hydroxy steroid. It derives from a hydride of a 5alpha-cholestane. | | Biological Activity | 5α,6β-dihydroxycholestanol (5α,6α-diOH-Chol) or cholestan-3β,5α,6β-triol (C-triol) levels are elevated along with 7-ketocholesterol in Niemann-Pick type C (NP-C) disease and is a key biomarkers for detection. It exhibits neuroprotective functionality during central nervous system (CNS) ischemia. |
| | CHOLESTANE-3β,5α,6β-TRIOL Preparation Products And Raw materials |
|